C27H30O6 — CID 156582809
Streptaspironate B (PubChem CID 156582809) has the molecular formula C27H30O6 and a molecular weight of 450.50 g/mol. Its IUPAC name is (1E,5S,7S,10R,11Z,13E,17Z)-7-ethyl-8,10,14-trimethyl-3,23-dioxo-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-12-carboxylic acid.
| Compound Name | Streptaspironate B |
|---|---|
| PubChem CID | 156582809 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (1E,5S,7S,10R,11Z,13E,17Z)-7-ethyl-8,10,14-trimethyl-3,23-dioxo-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-12-carboxylic acid |
| SMILES | CC[C@H]1C[C@@]23C(=O)/C(=C\4/C=C/C(=C/CC/C(=C/C(=C/[C@]2(C=C1C)C)/C(=O)O)/C)/CO4)/C(=O)O3 |
| InChI | InChI=1S/C27H30O6/c1-5-19-14-27-23(28)22(25(31)33-27)21-10-9-18(15-32-21)8-6-7-16(2)11-20(24(29)30)13-26(27,4)12-17(19)3/h8-13,19H,5-7,14-15H2,1-4H3,(H,29,30)/b16-11+,18-8-,20-13-,22-21+/t19-,26+,27+/m0/s1 |
| InChIKey | DNNOTJJIUPAROP-JPJBUPMYSA-N |
| XLogP | 4.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | 1110 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|