C19H19NO3 — CID 156582856
(2S,3R,5'R)-2-hydroxy-1',5'-dimethyl-7-phenylspiro[2,5-dihydrofuro[3,2-c]pyridine-3,3'-cyclopentene]-4-one (PubChem CID 156582856) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (2S,3R,5'R)-2-hydroxy-1',5'-dimethyl-7-phenylspiro[2,5-dihydrofuro[3,2-c]pyridine-3,3'-cyclopentene]-4-one.
| Compound Name | (2S,3R,5'R)-2-hydroxy-1',5'-dimethyl-7-phenylspiro[2,5-dihydrofuro[3,2-c]pyridine-3,3'-cyclopentene]-4-one |
|---|---|
| PubChem CID | 156582856 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2S,3R,5'R)-2-hydroxy-1',5'-dimethyl-7-phenylspiro[2,5-dihydrofuro[3,2-c]pyridine-3,3'-cyclopentene]-4-one |
| SMILES | CC1=C[C@]2(C[C@H]1C)c1c(c(-c3ccccc3)c[nH]c1=O)O[C@@H]2O |
| InChI | InChI=1S/C19H19NO3/c1-11-8-19(9-12(11)2)15-16(23-18(19)22)14(10-20-17(15)21)13-6-4-3-5-7-13/h3-8,10,12,18,22H,9H2,1-2H3,(H,20,21)/t12-,18+,19+/m1/s1 |
| InChIKey | VIXDBAHFGZDYIO-HQOQDVMHSA-N |
| XLogP | 2.98 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|