C22H34O6 — CID 156582916
[(1R,4R,5R,6R,9S,12S,13R,16R)-6,13,16-trihydroxy-5-(hydroxymethyl)-5,9-dimethyl-13-tetracyclo[10.3.1.01,10.04,9]hexadec-10-enyl]methyl acetate (PubChem CID 156582916) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is [(1R,4R,5R,6R,9S,12S,13R,16R)-6,13,16-trihydroxy-5-(hydroxymethyl)-5,9-dimethyl-13-tetracyclo[10.3.1.01,10.04,9]hexadec-10-enyl]methyl acetate.
| Compound Name | [(1R,4R,5R,6R,9S,12S,13R,16R)-6,13,16-trihydroxy-5-(hydroxymethyl)-5,9-dimethyl-13-tetracyclo[10.3.1.01,10.04,9]hexadec-10-enyl]methyl acetate |
|---|---|
| PubChem CID | 156582916 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [(1R,4R,5R,6R,9S,12S,13R,16R)-6,13,16-trihydroxy-5-(hydroxymethyl)-5,9-dimethyl-13-tetracyclo[10.3.1.01,10.04,9]hexadec-10-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(O)CC[C@]23CC[C@H]4[C@](C)(CO)[C@H](O)CC[C@]4(C)C2=C[C@H]1[C@H]3O |
| InChI | InChI=1S/C22H34O6/c1-13(24)28-12-22(27)9-8-21-7-4-15-19(2,16(21)10-14(22)18(21)26)6-5-17(25)20(15,3)11-23/h10,14-15,17-18,23,25-27H,4-9,11-12H2,1-3H3/t14-,15+,17+,18+,19-,20-,21+,22-/m0/s1 |
| InChIKey | ISDNAYJHEUWYFM-HEPFSLRFSA-N |
| XLogP | 1.55 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|