C26H42O5 — CID 156582943
(2R)-2-[(2S,5S,7R,8E,13R,14E,17S)-5,7,9,13,15,17-hexamethyl-10,18-dioxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid (PubChem CID 156582943) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is (2R)-2-[(2S,5S,7R,8E,13R,14E,17S)-5,7,9,13,15,17-hexamethyl-10,18-dioxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid.
| Compound Name | (2R)-2-[(2S,5S,7R,8E,13R,14E,17S)-5,7,9,13,15,17-hexamethyl-10,18-dioxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid |
|---|---|
| PubChem CID | 156582943 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (2R)-2-[(2S,5S,7R,8E,13R,14E,17S)-5,7,9,13,15,17-hexamethyl-10,18-dioxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid |
| SMILES | C/C1=C\[C@H](C)CCC(=O)/C(C)=C/[C@H](C)C[C@@H](C)CC[C@@H]([C@@H](C)C(=O)O)OC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C26H42O5/c1-16-8-10-23(27)20(5)14-18(3)13-17(2)9-11-24(22(7)25(28)29)31-26(30)21(6)15-19(4)12-16/h12,14,16-18,21-22,24H,8-11,13,15H2,1-7H3,(H,28,29)/b19-12+,20-14+/t16-,17+,18-,21+,22-,24+/m1/s1 |
| InChIKey | MKWDHXFCVJHRLY-LYTNLGRYSA-N |
| XLogP | 5.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|