C26H44O6 — CID 156582946
(2R)-2-[(2S,5S,7R,10R,12S,13S,17S)-10,12-dihydroxy-5,7,9,13,15,17-hexamethyl-18-oxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid (PubChem CID 156582946) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is (2R)-2-[(2S,5S,7R,10R,12S,13S,17S)-10,12-dihydroxy-5,7,9,13,15,17-hexamethyl-18-oxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid.
| Compound Name | (2R)-2-[(2S,5S,7R,10R,12S,13S,17S)-10,12-dihydroxy-5,7,9,13,15,17-hexamethyl-18-oxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid |
|---|---|
| PubChem CID | 156582946 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (2R)-2-[(2S,5S,7R,10R,12S,13S,17S)-10,12-dihydroxy-5,7,9,13,15,17-hexamethyl-18-oxo-1-oxacyclooctadeca-8,14-dien-2-yl]propanoic acid |
| SMILES | CC1=C[C@H](C)[C@@H](O)C[C@@H](O)C(C)=C[C@H](C)C[C@@H](C)CC[C@@H]([C@@H](C)C(=O)O)OC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C26H44O6/c1-15-8-9-24(21(7)25(29)30)32-26(31)20(6)13-17(3)12-19(5)23(28)14-22(27)18(4)11-16(2)10-15/h11-12,15-16,19-24,27-28H,8-10,13-14H2,1-7H3,(H,29,30)/t15-,16+,19-,20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | AASGDXOBGDUOJJ-XJHWUDEASA-N |
| XLogP | 4.74 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|