C16H12O7 — CID 156582952
(1R)-1-methyl-4-[2-(2,4,5-trihydroxyphenyl)ethenyl]-1H-furo[3,4-c]pyran-3,6-dione (PubChem CID 156582952) has the molecular formula C16H12O7 and a molecular weight of 316.27 g/mol. Its IUPAC name is (1R)-1-methyl-4-[2-(2,4,5-trihydroxyphenyl)ethenyl]-1H-furo[3,4-c]pyran-3,6-dione.
| Compound Name | (1R)-1-methyl-4-[2-(2,4,5-trihydroxyphenyl)ethenyl]-1H-furo[3,4-c]pyran-3,6-dione |
|---|---|
| PubChem CID | 156582952 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (1R)-1-methyl-4-[2-(2,4,5-trihydroxyphenyl)ethenyl]-1H-furo[3,4-c]pyran-3,6-dione |
| SMILES | C[C@H]1OC(=O)c2c1cc(=O)oc2C=Cc1cc(O)c(O)cc1O |
| InChI | InChI=1S/C16H12O7/c1-7-9-5-14(20)23-13(15(9)16(21)22-7)3-2-8-4-11(18)12(19)6-10(8)17/h2-7,17-19H,1H3/t7-/m1/s1 |
| InChIKey | KVTACKDCSKCUAO-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|