C28H32O10 — CID 156582980
methyl (3R,4aR,4bS,10aS,10bS,11S,12aR)-11-acetyloxy-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-10b,11-dihydronaphtho[2,1-f]isochromene-4a-carboxylate (PubChem CID 156582980) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is methyl (3R,4aR,4bS,10aS,10bS,11S,12aR)-11-acetyloxy-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-10b,11-dihydronaphtho[2,1-f]isochromene-4a-carboxylate.
| Compound Name | methyl (3R,4aR,4bS,10aS,10bS,11S,12aR)-11-acetyloxy-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-10b,11-dihydronaphtho[2,1-f]isochromene-4a-carboxylate |
|---|---|
| PubChem CID | 156582980 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | methyl (3R,4aR,4bS,10aS,10bS,11S,12aR)-11-acetyloxy-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-10b,11-dihydronaphtho[2,1-f]isochromene-4a-carboxylate |
| SMILES | C=C1[C@@H](OC(C)=O)[C@@H]2[C@](C)(C(=O)C(O)=C3C(C)(C)C(=O)C=C[C@]32C)[C@]2(C(=O)OC)C(=O)[C@@H](C)OC(=O)[C@]12C |
| InChI | InChI=1S/C28H32O10/c1-12-17(38-14(3)29)19-25(6)11-10-15(30)24(4,5)18(25)16(31)21(33)27(19,8)28(23(35)36-9)20(32)13(2)37-22(34)26(12,28)7/h10-11,13,17,19,31H,1H2,2-9H3/t13-,17-,19+,25-,26+,27-,28+/m1/s1 |
| InChIKey | CDQXYTLYCDABPX-FYGPHMSISA-N |
| XLogP | 2.36 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|