C15H22O3 — CID 156583142
(6R,7aR,7bS)-7a-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-2,4a,5,7-tetrahydro-1H-cyclobuta[e]inden-4-one (PubChem CID 156583142) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (6R,7aR,7bS)-7a-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-2,4a,5,7-tetrahydro-1H-cyclobuta[e]inden-4-one.
| Compound Name | (6R,7aR,7bS)-7a-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-2,4a,5,7-tetrahydro-1H-cyclobuta[e]inden-4-one |
|---|---|
| PubChem CID | 156583142 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (6R,7aR,7bS)-7a-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-2,4a,5,7-tetrahydro-1H-cyclobuta[e]inden-4-one |
| SMILES | CC1=C2CC[C@]2(C)[C@@]2(O)C[C@](C)(CO)CC2C1=O |
| InChI | InChI=1S/C15H22O3/c1-9-10-4-5-14(10,3)15(18)7-13(2,8-16)6-11(15)12(9)17/h11,16,18H,4-8H2,1-3H3/t11?,13-,14+,15-/m1/s1 |
| InChIKey | ZPIZSKXOKGRTNT-CHEQUFIKSA-N |
| XLogP | 1.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |