C18H25FN2O6 — CID 156584533
3-fluoro-N-[(1S,2S,4S)-2-hydroxy-4-[2-(2-hydroxyethoxy)ethylcarbamoyl]cyclopentyl]-4-methoxybenzamide (PubChem CID 156584533) has the molecular formula C18H25FN2O6 and a molecular weight of 384.40 g/mol. Its IUPAC name is 3-fluoro-N-[(1S,2S,4S)-2-hydroxy-4-[2-(2-hydroxyethoxy)ethylcarbamoyl]cyclopentyl]-4-methoxybenzamide.
| Compound Name | 3-fluoro-N-[(1S,2S,4S)-2-hydroxy-4-[2-(2-hydroxyethoxy)ethylcarbamoyl]cyclopentyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 156584533 |
| Molecular Formula | C18H25FN2O6 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-fluoro-N-[(1S,2S,4S)-2-hydroxy-4-[2-(2-hydroxyethoxy)ethylcarbamoyl]cyclopentyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2C[C@H](C(=O)NCCOCCO)C[C@@H]2O)cc1F |
| InChI | InChI=1S/C18H25FN2O6/c1-26-16-3-2-11(8-13(16)19)18(25)21-14-9-12(10-15(14)23)17(24)20-4-6-27-7-5-22/h2-3,8,12,14-15,22-23H,4-7,9-10H2,1H3,(H,20,24)(H,21,25)/t12-,14-,15-/m0/s1 |
| InChIKey | JAGDDXXZEWFEQX-QEJZJMRPSA-N |
| XLogP | -0.17 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|