C16H21FN2O4 — CID 156584536
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-[(4-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 156584536) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-[(4-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 156584536 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)N[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O4/c1-19(6-10-2-4-11(17)5-3-10)7-14(21)18-12-8-22-16-13(20)9-23-15(12)16/h2-5,12-13,15-16,20H,6-9H2,1H3,(H,18,21)/t12-,13-,15-,16-/m1/s1 |
| InChIKey | QHGHDJINWYNTMM-RRCSTGOVSA-N |
| XLogP | -0.10 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |