C21H26N4O4 — CID 156584695
N-[(1R,2R,4S)-2-hydroxy-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylcarbamoyl]cyclohexyl]-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 156584695) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-hydroxy-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylcarbamoyl]cyclohexyl]-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-[(1R,2R,4S)-2-hydroxy-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylcarbamoyl]cyclohexyl]-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 156584695 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(1R,2R,4S)-2-hydroxy-4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylcarbamoyl]cyclohexyl]-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | Cc1nc(CNC(=O)[C@H]2CC[C@@H](NC(=O)C3Cc4ccccc4C3)[C@H](O)C2)no1 |
| InChI | InChI=1S/C21H26N4O4/c1-12-23-19(25-29-12)11-22-20(27)15-6-7-17(18(26)10-15)24-21(28)16-8-13-4-2-3-5-14(13)9-16/h2-5,15-18,26H,6-11H2,1H3,(H,22,27)(H,24,28)/t15-,17+,18+/m0/s1 |
| InChIKey | VAPBHAWCAGILGJ-CGTJXYLNSA-N |
| XLogP | 1.06 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |