C15H21F3N4O5 — CID 156586244
(1S,3S,4S)-3-hydroxy-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-4-(4,4,4-trifluorobutanoylamino)cyclopentane-1-carboxamide (PubChem CID 156586244) has the molecular formula C15H21F3N4O5 and a molecular weight of 394.35 g/mol. Its IUPAC name is (1S,3S,4S)-3-hydroxy-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-4-(4,4,4-trifluorobutanoylamino)cyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-3-hydroxy-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-4-(4,4,4-trifluorobutanoylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 156586244 |
| Molecular Formula | C15H21F3N4O5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (1S,3S,4S)-3-hydroxy-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-4-(4,4,4-trifluorobutanoylamino)cyclopentane-1-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)[C@H]1C[C@H](NC(=O)CCC(F)(F)F)[C@@H](O)C1 |
| InChI | InChI=1S/C15H21F3N4O5/c1-8-14(22-27-21-8)26-5-4-19-13(25)9-6-10(11(23)7-9)20-12(24)2-3-15(16,17)18/h9-11,23H,2-7H2,1H3,(H,19,25)(H,20,24)/t9-,10-,11-/m0/s1 |
| InChIKey | YRLXDFRWAYXRNP-DCAQKATOSA-N |
| XLogP | 0.47 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|