About CID 156588551
CID 156588551 (PubChem CID 156588551) has the molecular formula C17H9F5NO4S
and a molecular weight of 418.32 g/mol.
Molecular Properties
| Compound Name | CID 156588551 |
| PubChem CID | 156588551 |
| Molecular Formula | C17H9F5NO4S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | — |
| SMILES | N#Cc1cc(F)cc(Oc2ccc(S(=O)(=O)C(F)F)c3c2CC(F)(F)[C]3O)c1 |
| InChI | InChI=1S/C17H9F5NO4S/c18-9-3-8(7-23)4-10(5-9)27-12-1-2-13(28(25,26)16(19)20)14-11(12)6-17(21,22)15(14)24/h1-5,16,24H,6H2 |
| InChIKey | BBBBLMZBVDYOLL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 156588551 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156588551?
The IUPAC name of CID 156588551 (CID 156588551) is not available.
What is the SMILES notation for CID 156588551?
The canonical SMILES for CID 156588551 is N#Cc1cc(F)cc(Oc2ccc(S(=O)(=O)C(F)F)c3c2CC(F)(F)[C]3O)c1.
What is the InChIKey of CID 156588551?
The InChIKey is BBBBLMZBVDYOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F5NO4S/c18-9-3-8(7-23)4-10(5-9)27-12-1-2-13(28(25,26)16(19)20)14-11(12)6-17(21,22)15(14)24/h1-5,16,24H,6H2.
What are the key properties of CID 156588551?
CID 156588551 has a molecular weight of 418.32 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156588551 is sourced from PubChem (CID 156588551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).