C17H9F5NO4S — CID 156588551
CID 156588551 (PubChem CID 156588551) has the molecular formula C17H9F5NO4S and a molecular weight of 418.32 g/mol.
| Compound Name | CID 156588551 |
|---|---|
| PubChem CID | 156588551 |
| Molecular Formula | C17H9F5NO4S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | — |
| SMILES | N#Cc1cc(F)cc(Oc2ccc(S(=O)(=O)C(F)F)c3c2CC(F)(F)[C]3O)c1 |
| InChI | InChI=1S/C17H9F5NO4S/c18-9-3-8(7-23)4-10(5-9)27-12-1-2-13(28(25,26)16(19)20)14-11(12)6-17(21,22)15(14)24/h1-5,16,24H,6H2 |
| InChIKey | BBBBLMZBVDYOLL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |