About C7H10F3N2O5S
C7H10F3N2O5S (PubChem CID 156588632) has the molecular formula C7H10F3N2O5S
and a molecular weight of 291.23 g/mol.
Molecular Properties
| Compound Name | C7H10F3N2O5S |
| PubChem CID | 156588632 |
| Molecular Formula | C7H10F3N2O5S |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | — |
| SMILES | N[C](CS)C(=O)NCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H9N2O3S.C2HF3O2/c6-3(2-11)5(10)7-1-4(8)9;3-2(4,5)1(6)7/h11H,1-2,6H2,(H,7,10)(H,8,9);(H,6,7) |
| InChIKey | WOFJAJCBASKILO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze C7H10F3N2O5S with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of C7H10F3N2O5S?
The IUPAC name of C7H10F3N2O5S (CID 156588632) is not available.
What is the SMILES notation for C7H10F3N2O5S?
The canonical SMILES for C7H10F3N2O5S is N[C](CS)C(=O)NCC(=O)O.O=C(O)C(F)(F)F.
What is the InChIKey of C7H10F3N2O5S?
The InChIKey is WOFJAJCBASKILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N2O3S.C2HF3O2/c6-3(2-11)5(10)7-1-4(8)9;3-2(4,5)1(6)7/h11H,1-2,6H2,(H,7,10)(H,8,9);(H,6,7).
What are the key properties of C7H10F3N2O5S?
C7H10F3N2O5S has a molecular weight of 291.23 g/mol, XLogP of -0.76, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for C7H10F3N2O5S is sourced from PubChem (CID 156588632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).