C11H19ClN2O — CID 156589399
[3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;hydrochloride (PubChem CID 156589399) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is [3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;hydrochloride.
| Compound Name | [3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 156589399 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [3-[(dimethylamino)methyl]-4-methoxyphenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(CN)cc1CN(C)C.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-13(2)8-10-6-9(7-12)4-5-11(10)14-3;/h4-6H,7-8,12H2,1-3H3;1H |
| InChIKey | FMCJGGATJGYAAP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |