C20H24N4O2S — CID 156590470
1,3,7-trimethyl-5-(naphthalen-1-ylmethylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 156590470) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1,3,7-trimethyl-5-(naphthalen-1-ylmethylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3,7-trimethyl-5-(naphthalen-1-ylmethylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156590470 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1,3,7-trimethyl-5-(naphthalen-1-ylmethylsulfanyl)-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CC1NC(SCc2cccc3ccccc23)C2C(=O)N(C)C(=O)N(C)C2N1 |
| InChI | InChI=1S/C20H24N4O2S/c1-12-21-17-16(19(25)24(3)20(26)23(17)2)18(22-12)27-11-14-9-6-8-13-7-4-5-10-15(13)14/h4-10,12,16-18,21-22H,11H2,1-3H3 |
| InChIKey | ZIVQRWGVKGPDET-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |