C22H29BrN2O2 — CID 156590545
4-(4-benzylpiperidine-1-carbonyl)-6-bromo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 156590545) has the molecular formula C22H29BrN2O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 4-(4-benzylpiperidine-1-carbonyl)-6-bromo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | 4-(4-benzylpiperidine-1-carbonyl)-6-bromo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 156590545 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-(4-benzylpiperidine-1-carbonyl)-6-bromo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | O=C1CC(C(=O)N2CCC(Cc3ccccc3)CC2)C2CC(Br)CCC2N1 |
| InChI | InChI=1S/C22H29BrN2O2/c23-17-6-7-20-18(13-17)19(14-21(26)24-20)22(27)25-10-8-16(9-11-25)12-15-4-2-1-3-5-15/h1-5,16-20H,6-14H2,(H,24,26) |
| InChIKey | WRPMTRRKONKJOY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|