C26H27FN4O5 — CID 156590816
2-(4-fluorophenyl)-5-[[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl]-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 156590816) has the molecular formula C26H27FN4O5 and a molecular weight of 494.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl]-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-(4-fluorophenyl)-5-[[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl]-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 156590816 |
| Molecular Formula | C26H27FN4O5 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl]-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | COc1cc(-c2nc(CN3C=CN4NC(c5ccc(F)cc5)CC4C3=O)c(C)o2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27FN4O5/c1-15-20(28-25(36-15)17-11-22(33-2)24(35-4)23(12-17)34-3)14-30-9-10-31-21(26(30)32)13-19(29-31)16-5-7-18(27)8-6-16/h5-12,19,21,29H,13-14H2,1-4H3 |
| InChIKey | OWEOIBGONKXWEA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |