C13H19N5O2 — CID 156591279
(E)-N-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]but-2-enamide (PubChem CID 156591279) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is (E)-N-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]but-2-enamide.
| Compound Name | (E)-N-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 156591279 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (E)-N-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cc(C)nn1C1NC(=O)CC(C)N1 |
| InChI | InChI=1S/C13H19N5O2/c1-4-5-11(19)15-10-6-9(3)17-18(10)13-14-8(2)7-12(20)16-13/h4-6,8,13-14H,7H2,1-3H3,(H,15,19)(H,16,20)/b5-4+ |
| InChIKey | CVZJAJUQOFQVRC-SNAWJCMRSA-N |
| XLogP | 0.66 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|