C32H52N4O7S2 — CID 15659176
(2S)-N-[2-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]amino]-2-oxo-1-prop-2-enylsulfanylethyl]-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanamide (PubChem CID 15659176) has the molecular formula C32H52N4O7S2 and a molecular weight of 668.92 g/mol. Its IUPAC name is (2S)-N-[2-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]amino]-2-oxo-1-prop-2-enylsulfanylethyl]-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanamide.
| Compound Name | (2S)-N-[2-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]amino]-2-oxo-1-prop-2-enylsulfanylethyl]-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 15659176 |
| Molecular Formula | C32H52N4O7S2 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | (2S)-N-[2-[[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]amino]-2-oxo-1-prop-2-enylsulfanylethyl]-2-(morpholin-4-ylsulfonylamino)-3-phenylpropanamide |
| SMILES | C=CCSC(NC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)N1CCOCC1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C32H52N4O7S2/c1-4-19-44-32(31(40)33-26(21-24-11-7-5-8-12-24)29(38)28(37)20-23(2)3)34-30(39)27(22-25-13-9-6-10-14-25)35-45(41,42)36-15-17-43-18-16-36/h4,6,9-10,13-14,23-24,26-29,32,35,37-38H,1,5,7-8,11-12,15-22H2,2-3H3,(H,33,40)(H,34,39)/t26-,27-,28-,29+,32?/m0/s1 |
| InChIKey | ZPQDRLPJUKSWIJ-GDZMZIAQSA-N |
| XLogP | 2.35 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|