C20H22N8O5 — CID 156593072
1-benzyl-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3,7-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 156593072) has the molecular formula C20H22N8O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is 1-benzyl-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3,7-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 1-benzyl-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156593072 |
| Molecular Formula | C20H22N8O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-benzyl-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2)C(=O)C2C1N=C(/N=N/c1c(O)n(C)c(=O)n(C)c1=O)N2C |
| InChI | InChI=1S/C20H22N8O5/c1-24-13-14(25(2)20(33)28(17(13)31)10-11-8-6-5-7-9-11)21-18(24)23-22-12-15(29)26(3)19(32)27(4)16(12)30/h5-9,13-14,29H,10H2,1-4H3/b23-22+ |
| InChIKey | MNNKLVXOQGNTEF-GHVJWSGMSA-N |
| XLogP | -0.04 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|