C14H18N8O5 — CID 156593104
7-butyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 156593104) has the molecular formula C14H18N8O5 and a molecular weight of 378.35 g/mol. Its IUPAC name is 7-butyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-butyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156593104 |
| Molecular Formula | C14H18N8O5 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 7-butyl-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCN1C(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C14H18N8O5/c1-3-4-5-22-7-8(21(2)14(27)18-11(7)25)15-12(22)20-19-6-9(23)16-13(26)17-10(6)24/h7-8H,3-5H2,1-2H3,(H,18,25,27)(H3,16,17,23,24,26)/b20-19+ |
| InChIKey | MQFZQZSWEQGABT-FMQUCBEESA-N |
| XLogP | -0.80 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|