C20H24N2O5 — CID 156593166
ethyl 4-[3-(4-ethoxy-2-hydroxyphenyl)pyrazolidin-4-yl]oxybenzoate (PubChem CID 156593166) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 4-[3-(4-ethoxy-2-hydroxyphenyl)pyrazolidin-4-yl]oxybenzoate.
| Compound Name | ethyl 4-[3-(4-ethoxy-2-hydroxyphenyl)pyrazolidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 156593166 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl 4-[3-(4-ethoxy-2-hydroxyphenyl)pyrazolidin-4-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC2CNNC2c2ccc(OCC)cc2O)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-3-25-15-9-10-16(17(23)11-15)19-18(12-21-22-19)27-14-7-5-13(6-8-14)20(24)26-4-2/h5-11,18-19,21-23H,3-4,12H2,1-2H3 |
| InChIKey | VFFZQHZTKAFAOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|