C34H46N4O8 — CID 156593638
3-[(4Z,10Z,15Z,19Z)-18-(2-carboxyethyl)-7,12-bis(1,2-dihydroxyethyl)-3,8,13,17-tetramethyl-1,2,3,12,13,14,21,22,23,24-decahydroporphyrin-2-yl]propanoic acid (PubChem CID 156593638) has the molecular formula C34H46N4O8 and a molecular weight of 638.76 g/mol. Its IUPAC name is 3-[(4Z,10Z,15Z,19Z)-18-(2-carboxyethyl)-7,12-bis(1,2-dihydroxyethyl)-3,8,13,17-tetramethyl-1,2,3,12,13,14,21,22,23,24-decahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(4Z,10Z,15Z,19Z)-18-(2-carboxyethyl)-7,12-bis(1,2-dihydroxyethyl)-3,8,13,17-tetramethyl-1,2,3,12,13,14,21,22,23,24-decahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 156593638 |
| Molecular Formula | C34H46N4O8 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 3-[(4Z,10Z,15Z,19Z)-18-(2-carboxyethyl)-7,12-bis(1,2-dihydroxyethyl)-3,8,13,17-tetramethyl-1,2,3,12,13,14,21,22,23,24-decahydroporphyrin-2-yl]propanoic acid |
| SMILES | Cc1c2[nH]c(c1C(O)CO)/C=C1\NC(/C=c3\[nH]/c(c(C)c3CCC(=O)O)=C\C3N/C(=C\2)C(C(O)CO)C3C)C(CCC(=O)O)C1C |
| InChI | InChI=1S/C34H46N4O8/c1-15-19(5-7-31(43)44)25-12-26-20(6-8-32(45)46)16(2)22(36-26)10-27-34(30(42)14-40)18(4)24(38-27)11-28-33(29(41)13-39)17(3)23(37-28)9-21(15)35-25/h9-12,16-17,20,23,26,29-30,33,35-42H,5-8,13-14H2,1-4H3,(H,43,44)(H,45,46)/b21-9-,22-10-,25-12-,28-11- |
| InChIKey | QYSXPUFNPKQTJL-RXCYZOFLSA-N |
| XLogP | 0.63 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |