C14H17BrN2O — CID 156593877
1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)methanamine;hydrobromide (PubChem CID 156593877) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)methanamine;hydrobromide.
| Compound Name | 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)methanamine;hydrobromide |
|---|---|
| PubChem CID | 156593877 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)methanamine;hydrobromide |
| SMILES | Br.COc1ccc(CNCc2ccncc2)cc1 |
| InChI | InChI=1S/C14H16N2O.BrH/c1-17-14-4-2-12(3-5-14)10-16-11-13-6-8-15-9-7-13;/h2-9,16H,10-11H2,1H3;1H |
| InChIKey | HCEOAPTZOVPMQK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |