C22H28O11 — CID 156593907
(PubChem CID 156593907) has the molecular formula C22H28O11 and a molecular weight of 468.46 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 156593907 |
| Molecular Formula | C22H28O11 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2=COC3CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC(O)C3C2=O)cc1O |
| InChI | InChI=1S/C22H28O11/c1-30-14-3-2-9(4-12(14)24)11-8-31-15-6-10(5-13(25)17(15)18(11)26)32-22-21(29)20(28)19(27)16(7-23)33-22/h2-4,8,10,13,15-17,19-25,27-29H,5-7H2,1H3/t10?,13?,15?,16-,17?,19-,20+,21-,22-/m1/s1 |
| InChIKey | WSDAKYZKKRBEIH-WITJTQJTSA-N |
| XLogP | -1.33 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |