About 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one
3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one (PubChem CID 15659413) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one.
Molecular Properties
| Compound Name | 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one |
| PubChem CID | 15659413 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one |
| SMILES | CC(C)CC(=O)c1c(O)cc(O)c(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C16H22O5/c1-8(2)5-10(17)14-12(19)7-13(20)15(16(14)21)11(18)6-9(3)4/h7-9,19-21H,5-6H2,1-4H3 |
| InChIKey | FKOJGSQCIDUOCC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one?
The IUPAC name of 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one (CID 15659413) is 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one.
What is the SMILES notation for 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one?
The canonical SMILES for 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one is CC(C)CC(=O)c1c(O)cc(O)c(C(=O)CC(C)C)c1O.
What is the InChIKey of 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one?
The InChIKey is FKOJGSQCIDUOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5/c1-8(2)5-10(17)14-12(19)7-13(20)15(16(14)21)11(18)6-9(3)4/h7-9,19-21H,5-6H2,1-4H3.
What are the key properties of 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one?
3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one has a molecular weight of 294.35 g/mol, XLogP of 3.26, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[2,4,6-trihydroxy-3-(3-methylbutanoyl)phenyl]butan-1-one is sourced from PubChem (CID 15659413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).