C16H22O5 — CID 15659417
3,5-dihydroxy-6,6-dimethyl-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 15659417) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3,5-dihydroxy-6,6-dimethyl-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-6,6-dimethyl-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15659417 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3,5-dihydroxy-6,6-dimethyl-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)C(=O)C1=C(O)C(C(=O)C(C)C)=C(O)C(C)(C)C1=O |
| InChI | InChI=1S/C16H22O5/c1-7(2)11(17)9-13(19)10(12(18)8(3)4)15(21)16(5,6)14(9)20/h7-8,19-20H,1-6H3 |
| InChIKey | MRAYMQQKMGSTLP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|