C18H26O5 — CID 15659418
6,6-diethyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 15659418) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 6,6-diethyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6,6-diethyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15659418 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 6,6-diethyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CCC1(CC)C(=O)C(C(=O)C(C)C)=C(O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C18H26O5/c1-7-18(8-2)16(22)11(13(19)9(3)4)15(21)12(17(18)23)14(20)10(5)6/h9-10,21-22H,7-8H2,1-6H3 |
| InChIKey | JQLOQWZSRXJYIL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|