C22H34O5 — CID 15659420
6,6-dibutyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 15659420) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 6,6-dibutyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6,6-dibutyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15659420 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 6,6-dibutyl-3,5-dihydroxy-2,4-bis(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CCCCC1(CCCC)C(=O)C(C(=O)C(C)C)=C(O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C22H34O5/c1-7-9-11-22(12-10-8-2)20(26)15(17(23)13(3)4)19(25)16(21(22)27)18(24)14(5)6/h13-14,25-26H,7-12H2,1-6H3 |
| InChIKey | YAAYZDBDAVXWFW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|