C24H38O5 — CID 15659421
3,5-dihydroxy-2,4-bis(2-methylpropanoyl)-6,6-dipentylcyclohexa-2,4-dien-1-one (PubChem CID 15659421) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 3,5-dihydroxy-2,4-bis(2-methylpropanoyl)-6,6-dipentylcyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-2,4-bis(2-methylpropanoyl)-6,6-dipentylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15659421 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3,5-dihydroxy-2,4-bis(2-methylpropanoyl)-6,6-dipentylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCC1(CCCCC)C(=O)C(C(=O)C(C)C)=C(O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C24H38O5/c1-7-9-11-13-24(14-12-10-8-2)22(28)17(19(25)15(3)4)21(27)18(23(24)29)20(26)16(5)6/h15-16,27-28H,7-14H2,1-6H3 |
| InChIKey | QJYNAILBFYXZIH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|