About (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine
(Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine (PubChem CID 156594272) has the molecular formula C5H4ClF2N3
and a molecular weight of 179.56 g/mol. Its IUPAC name is (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine.
Molecular Properties
| Compound Name | (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine |
| PubChem CID | 156594272 |
| Molecular Formula | C5H4ClF2N3 |
| Molecular Weight | 179.56 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine |
| SMILES | N/N=C1\N=C(F)C(Cl)C=C1F |
| InChI | InChI=1S/C5H4ClF2N3/c6-2-1-3(7)5(11-9)10-4(2)8/h1-2H,9H2/b11-5- |
| InChIKey | ASXXMNDOBQPRFD-WZUFQYTHSA-N |
| XLogP | 1.10 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine?
The IUPAC name of (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine (CID 156594272) is (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine.
What is the SMILES notation for (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine?
The canonical SMILES for (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine is N/N=C1\N=C(F)C(Cl)C=C1F.
What is the InChIKey of (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine?
The InChIKey is ASXXMNDOBQPRFD-WZUFQYTHSA-N. The full InChI is InChI=1S/C5H4ClF2N3/c6-2-1-3(7)5(11-9)10-4(2)8/h1-2H,9H2/b11-5-.
What are the key properties of (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine?
(Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine has a molecular weight of 179.56 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-(3-chloro-2,5-difluoro-3H-pyridin-6-ylidene)hydrazine is sourced from PubChem (CID 156594272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).