C36H72O14 — CID 156595034
(Z)-octadec-9-enoic acid;2-[2,3,4,5,6-pentakis(2-hydroxyethoxy)hexoxy]ethanol (PubChem CID 156595034) has the molecular formula C36H72O14 and a molecular weight of 728.96 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;2-[2,3,4,5,6-pentakis(2-hydroxyethoxy)hexoxy]ethanol.
| Compound Name | (Z)-octadec-9-enoic acid;2-[2,3,4,5,6-pentakis(2-hydroxyethoxy)hexoxy]ethanol |
|---|---|
| PubChem CID | 156595034 |
| Molecular Formula | C36H72O14 |
| Molecular Weight | 728.96 g/mol |
| Exact Mass | 728.49 |
| IUPAC Name | (Z)-octadec-9-enoic acid;2-[2,3,4,5,6-pentakis(2-hydroxyethoxy)hexoxy]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.OCCOCC(OCCO)C(OCCO)C(OCCO)C(COCCO)OCCO |
| InChI | InChI=1S/C18H38O12.C18H34O2/c19-1-7-25-13-15(27-9-3-21)17(29-11-5-23)18(30-12-6-24)16(28-10-4-22)14-26-8-2-20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h15-24H,1-14H2;9-10H,2-8,11-17H2,1H3,(H,19,20)/b;10-9- |
| InChIKey | IQSJAAFHGCILRF-SVMKZPJVSA-N |
| XLogP | 2.62 |
| TPSA | 214.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.96 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|