About 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one
2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one (PubChem CID 156595105) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one |
| PubChem CID | 156595105 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one |
| SMILES | NC1=CN2C=CNC(=O)C2N1 |
| InChI | InChI=1S/C6H8N4O/c7-4-3-10-2-1-8-6(11)5(10)9-4/h1-3,5,9H,7H2,(H,8,11) |
| InChIKey | CNQQEMIYGPYVNR-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one?
The IUPAC name of 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one (CID 156595105) is 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one.
What is the SMILES notation for 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one?
The canonical SMILES for 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one is NC1=CN2C=CNC(=O)C2N1.
What is the InChIKey of 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one?
The InChIKey is CNQQEMIYGPYVNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c7-4-3-10-2-1-8-6(11)5(10)9-4/h1-3,5,9H,7H2,(H,8,11).
What are the key properties of 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one?
2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one has a molecular weight of 152.16 g/mol, XLogP of -1.42, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8a-dihydro-1H-imidazo[1,2-a]pyrazin-8-one is sourced from PubChem (CID 156595105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).