About [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride
[(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride (PubChem CID 156595142) has the molecular formula C6H16Cl2N2
and a molecular weight of 187.11 g/mol. Its IUPAC name is [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride |
| PubChem CID | 156595142 |
| Molecular Formula | C6H16Cl2N2 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NC[C@@H]1CC[C@@H]1CN |
| InChI | InChI=1S/C6H14N2.2ClH/c7-3-5-1-2-6(5)4-8;;/h5-6H,1-4,7-8H2;2*1H/t5-,6+;; |
| InChIKey | FCZGUISVPWFFBE-RUTFAPCESA-N |
| XLogP | 0.77 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride?
The IUPAC name of [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride (CID 156595142) is [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride.
What is the SMILES notation for [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride?
The canonical SMILES for [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride is Cl.Cl.NC[C@@H]1CC[C@@H]1CN.
What is the InChIKey of [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride?
The InChIKey is FCZGUISVPWFFBE-RUTFAPCESA-N. The full InChI is InChI=1S/C6H14N2.2ClH/c7-3-5-1-2-6(5)4-8;;/h5-6H,1-4,7-8H2;2*1H/t5-,6+;;.
What are the key properties of [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride?
[(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride has a molecular weight of 187.11 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride is sourced from PubChem (CID 156595142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).