About (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine
(Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine (PubChem CID 156595441) has the molecular formula C7H5F6N3
and a molecular weight of 245.13 g/mol. Its IUPAC name is (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine |
| PubChem CID | 156595441 |
| Molecular Formula | C7H5F6N3 |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine |
| SMILES | N/N=C1/C=C(C(F)(F)F)C(C(F)(F)F)C=N1 |
| InChI | InChI=1S/C7H5F6N3/c8-6(9,10)3-1-5(16-14)15-2-4(3)7(11,12)13/h1-2,4H,14H2/b16-5- |
| InChIKey | MTNPWXNRWREMKG-BNCCVWRVSA-N |
| XLogP | 2.01 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine?
The IUPAC name of (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine (CID 156595441) is (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine.
What is the SMILES notation for (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine?
The canonical SMILES for (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine is N/N=C1/C=C(C(F)(F)F)C(C(F)(F)F)C=N1.
What is the InChIKey of (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine?
The InChIKey is MTNPWXNRWREMKG-BNCCVWRVSA-N. The full InChI is InChI=1S/C7H5F6N3/c8-6(9,10)3-1-5(16-14)15-2-4(3)7(11,12)13/h1-2,4H,14H2/b16-5-.
What are the key properties of (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine?
(Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine has a molecular weight of 245.13 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[3,4-bis(trifluoromethyl)-3H-pyridin-6-ylidene]hydrazine is sourced from PubChem (CID 156595441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).