C27H31N7O2S — CID 156595827
(Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]-3-sulfanylprop-2-enamide (PubChem CID 156595827) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is (Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]-3-sulfanylprop-2-enamide.
| Compound Name | (Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]-3-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 156595827 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1H-indol-3-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]-3-sulfanylprop-2-enamide |
| SMILES | COc1cc(N(C)CCN(C)C)c(NC(=O)/C=C\S)cc1Nc1nccc(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C27H31N7O2S/c1-33(2)12-13-34(3)24-16-25(36-4)23(15-22(24)30-26(35)10-14-37)32-27-28-11-9-21(31-27)19-17-29-20-8-6-5-7-18(19)20/h5-11,14-17,29,37H,12-13H2,1-4H3,(H,30,35)(H,28,31,32)/b14-10- |
| InChIKey | GTBSJCQKZVBGKO-UVTDQMKNSA-N |
| XLogP | 4.76 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|