C17H23N3 — CID 156596008
4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethynyl]-N,N-dimethylaniline (PubChem CID 156596008) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethynyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 156596008 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#CC2CC3CCNCC3N2)cc1 |
| InChI | InChI=1S/C17H23N3/c1-20(2)16-7-4-13(5-8-16)3-6-15-11-14-9-10-18-12-17(14)19-15/h4-5,7-8,14-15,17-19H,9-12H2,1-2H3 |
| InChIKey | YSOBYXJILRVMDV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|