C18H23N3O4S — CID 156596378
(Z)-but-2-enedioic acid;N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine (PubChem CID 156596378) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | (Z)-but-2-enedioic acid;N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 156596378 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(Cc1ccsc1)c1ccccn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H19N3S.C4H4O4/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14;5-3(6)1-2-4(7)8/h3-7,10,12H,8-9,11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IJAXMJANRDPFDS-BTJKTKAUSA-N |
| XLogP | 2.42 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|