C16H20O8S — CID 156596522
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-methylsulfanyl-3-phenylpropanoyl]oxyoxane-2-carboxylic acid (PubChem CID 156596522) has the molecular formula C16H20O8S and a molecular weight of 372.40 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-methylsulfanyl-3-phenylpropanoyl]oxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-methylsulfanyl-3-phenylpropanoyl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 156596522 |
| Molecular Formula | C16H20O8S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-methylsulfanyl-3-phenylpropanoyl]oxyoxane-2-carboxylic acid |
| SMILES | CS[C@@H](Cc1ccccc1)C(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O8S/c1-25-9(7-8-5-3-2-4-6-8)15(22)24-16-12(19)10(17)11(18)13(23-16)14(20)21/h2-6,9-13,16-19H,7H2,1H3,(H,20,21)/t9-,10-,11-,12+,13-,16-/m0/s1 |
| InChIKey | DTRZTOQCGUHLED-BWEHONMYSA-N |
| XLogP | -0.60 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |