C12H16N2O4 — CID 156596630
(2R)-2-acetamido-3-hydroxy-N-[(4-hydroxyphenyl)methyl]propanamide (PubChem CID 156596630) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2R)-2-acetamido-3-hydroxy-N-[(4-hydroxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-acetamido-3-hydroxy-N-[(4-hydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 156596630 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2R)-2-acetamido-3-hydroxy-N-[(4-hydroxyphenyl)methyl]propanamide |
| SMILES | CC(=O)N[C@H](CO)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-8(16)14-11(7-15)12(18)13-6-9-2-4-10(17)5-3-9/h2-5,11,15,17H,6-7H2,1H3,(H,13,18)(H,14,16)/t11-/m1/s1 |
| InChIKey | QWRCHVAOLQXQLQ-LLVKDONJSA-N |
| XLogP | -0.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |