About methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate
methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate (PubChem CID 156597019) has the molecular formula C18H24O8
and a molecular weight of 368.38 g/mol. Its IUPAC name is methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate.
Molecular Properties
| Compound Name | methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate |
| PubChem CID | 156597019 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C\COC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C18H24O8/c1-12(5-6-15(20)23-4)7-8-24-16(21)10-13(19)9-14-11-17(22)26-18(2,3)25-14/h7,11H,5-6,8-10H2,1-4H3/b12-7- |
| InChIKey | CHFFGCMFPJOVDB-GHXNOFRVSA-N |
| XLogP | 1.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate?
The IUPAC name of methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate (CID 156597019) is methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate.
What is the SMILES notation for methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate?
The canonical SMILES for methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate is COC(=O)CC/C(C)=C\COC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate?
The InChIKey is CHFFGCMFPJOVDB-GHXNOFRVSA-N. The full InChI is InChI=1S/C18H24O8/c1-12(5-6-15(20)23-4)7-8-24-16(21)10-13(19)9-14-11-17(22)26-18(2,3)25-14/h7,11H,5-6,8-10H2,1-4H3/b12-7-.
What are the key properties of methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate?
methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate has a molecular weight of 368.38 g/mol, XLogP of 1.97, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-6-[4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoyl]oxy-4-methylhex-4-enoate is sourced from PubChem (CID 156597019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).