C29H33N3O11 — CID 156597169
methyl (2S,3S,4S,5R,6R)-6-[[(1R,3R,4R,5S)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 156597169) has the molecular formula C29H33N3O11 and a molecular weight of 599.59 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-6-[[(1R,3R,4R,5S)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-6-[[(1R,3R,4R,5S)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 156597169 |
| Molecular Formula | C29H33N3O11 |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[[(1R,3R,4R,5S)-3-acetyloxy-4-azido-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OC2[C@H]3CO[C@@H](O3)[C@H](N=[N+]=[N-])[C@H]2OC(C)=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C29H33N3O11/c1-16(33)40-23-20(31-32-30)28-39-15-19(41-28)22(23)42-29-26(38-14-18-11-7-4-8-12-18)24(21(34)25(43-29)27(35)36-2)37-13-17-9-5-3-6-10-17/h3-12,19-26,28-29,34H,13-15H2,1-2H3/t19-,20-,21+,22?,23-,24+,25+,26-,28+,29-/m1/s1 |
| InChIKey | ZLSPZMMAVWCECA-MHGFRSCXSA-N |
| XLogP | 2.17 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|