C18H30N2O8S2 — CID 156597182
2-[2-methylsulfonyloxyethyl-[2-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]ethyl]amino]ethyl methanesulfonate (PubChem CID 156597182) has the molecular formula C18H30N2O8S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[2-methylsulfonyloxyethyl-[2-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]ethyl]amino]ethyl methanesulfonate.
| Compound Name | 2-[2-methylsulfonyloxyethyl-[2-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]ethyl]amino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 156597182 |
| Molecular Formula | C18H30N2O8S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[2-methylsulfonyloxyethyl-[2-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]ethyl]amino]ethyl methanesulfonate |
| SMILES | C[C@H](NC(=O)COCCN(CCOS(C)(=O)=O)CCOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O8S2/c1-16(17-7-5-4-6-8-17)19-18(21)15-26-12-9-20(10-13-27-29(2,22)23)11-14-28-30(3,24)25/h4-8,16H,9-15H2,1-3H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | IKDJLCXKTZGHFR-INIZCTEOSA-N |
| XLogP | 0.13 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|