About 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide
2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 156597502) has the molecular formula C15H15N5O3S
and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide |
| PubChem CID | 156597502 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nncc2CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C15H15N5O3S/c1-10-2-4-11(5-3-10)17-13(21)8-20-12(6-16-18-20)7-19-14(22)9-24-15(19)23/h2-6H,7-9H2,1H3,(H,17,21) |
| InChIKey | BGMLSACTQSPYAM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide?
The IUPAC name of 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide (CID 156597502) is 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide.
What is the SMILES notation for 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide?
The canonical SMILES for 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide is Cc1ccc(NC(=O)Cn2nncc2CN2C(=O)CSC2=O)cc1.
What is the InChIKey of 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide?
The InChIKey is BGMLSACTQSPYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3S/c1-10-2-4-11(5-3-10)17-13(21)8-20-12(6-16-18-20)7-19-14(22)9-24-15(19)23/h2-6H,7-9H2,1H3,(H,17,21).
What are the key properties of 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide?
2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide has a molecular weight of 345.38 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]triazol-1-yl]-N-(4-methylphenyl)acetamide is sourced from PubChem (CID 156597502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).