C30H24N6O2 — CID 156597871
1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide (PubChem CID 156597871) has the molecular formula C30H24N6O2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 156597871 |
| Molecular Formula | C30H24N6O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-N,4-N-bis[4-(pyridin-4-ylamino)phenyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccncc2)cc1)c1ccc(C(=O)Nc2ccc(Nc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C30H24N6O2/c37-29(35-25-9-5-23(6-10-25)33-27-13-17-31-18-14-27)21-1-2-22(4-3-21)30(38)36-26-11-7-24(8-12-26)34-28-15-19-32-20-16-28/h1-20H,(H,31,33)(H,32,34)(H,35,37)(H,36,38) |
| InChIKey | NXISOMJXGNEHPB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |