C27H29F3N2O2S — CID 156598062
(1S,2R,13R,14S,18S)-2,18-dimethyl-7-[4-(trifluoromethoxy)anilino]-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 156598062) has the molecular formula C27H29F3N2O2S and a molecular weight of 502.60 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-2,18-dimethyl-7-[4-(trifluoromethoxy)anilino]-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-[4-(trifluoromethoxy)anilino]-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 156598062 |
| Molecular Formula | C27H29F3N2O2S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-[4-(trifluoromethoxy)anilino]-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | C[C@]12CCc3sc(Nc4ccc(OC(F)(F)F)cc4)nc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H29F3N2O2S/c1-25-14-12-21-23(32-24(35-21)31-15-3-5-16(6-4-15)34-27(28,29)30)20(25)8-7-17-18-9-10-22(33)26(18,2)13-11-19(17)25/h3-6,8,17-19H,7,9-14H2,1-2H3,(H,31,32)/t17-,18-,19-,25+,26-/m0/s1 |
| InChIKey | XLFQURFXNQRMRX-MMUXUBNZSA-N |
| XLogP | 7.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |