C20H13N5O5 — CID 156598078
5-[[5-(4-nitrophenyl)-1-phenylpyrazol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 156598078) has the molecular formula C20H13N5O5 and a molecular weight of 403.35 g/mol. Its IUPAC name is 5-[[5-(4-nitrophenyl)-1-phenylpyrazol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[5-(4-nitrophenyl)-1-phenylpyrazol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 156598078 |
| Molecular Formula | C20H13N5O5 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 5-[[5-(4-nitrophenyl)-1-phenylpyrazol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2cc(-c3ccc([N+](=O)[O-])cc3)n(-c3ccccc3)n2)C(=O)N1 |
| InChI | InChI=1S/C20H13N5O5/c26-18-16(19(27)22-20(28)21-18)10-13-11-17(12-6-8-15(9-7-12)25(29)30)24(23-13)14-4-2-1-3-5-14/h1-11H,(H2,21,22,26,27,28) |
| InChIKey | VMHMFDYEXDJHKZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|