C9H10N4O3 — CID 156598361
2-[2-(2H-tetrazol-5-yl)acetyl]cyclohexane-1,3-dione (PubChem CID 156598361) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[2-(2H-tetrazol-5-yl)acetyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-(2H-tetrazol-5-yl)acetyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 156598361 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[2-(2H-tetrazol-5-yl)acetyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C(=O)Cc1nn[nH]n1 |
| InChI | InChI=1S/C9H10N4O3/c14-5-2-1-3-6(15)9(5)7(16)4-8-10-12-13-11-8/h9H,1-4H2,(H,10,11,12,13) |
| InChIKey | JZBBGSJWCJSTTR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|