C24H42O2Si — CID 15659844
(1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one (PubChem CID 15659844) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one.
| Compound Name | (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one |
|---|---|
| PubChem CID | 15659844 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (1R,4R,8R,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyltricyclo[10.2.1.04,9]pentadec-11-en-3-one |
| SMILES | CC1(C)/C2=C/C[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]3(C)C(=O)C[C@H]1CC2 |
| InChI | InChI=1S/C24H42O2Si/c1-22(2,3)27(7,8)26-20-10-9-15-24(6)19(20)14-13-17-11-12-18(16-21(24)25)23(17,4)5/h13,18-20H,9-12,14-16H2,1-8H3/b17-13-/t18-,19+,20-,24-/m1/s1 |
| InChIKey | UNWZZEOWPXFPSL-CGWDLFQLSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|